C21H24ClN2O2+ — CID 2303685
(2R,3S)-2-(4-chlorophenyl)-1-(4-methoxyphenyl)-3-methyl-5,6,7,8-tetrahydro-3H-imidazo[1,2-a]pyridin-4-ium-2-ol (PubChem CID 2303685) has the molecular formula C21H24ClN2O2+ and a molecular weight of 371.89 g/mol. Its IUPAC name is (2R,3S)-2-(4-chlorophenyl)-1-(4-methoxyphenyl)-3-methyl-5,6,7,8-tetrahydro-3H-imidazo[1,2-a]pyridin-4-ium-2-ol.
| Compound Name | (2R,3S)-2-(4-chlorophenyl)-1-(4-methoxyphenyl)-3-methyl-5,6,7,8-tetrahydro-3H-imidazo[1,2-a]pyridin-4-ium-2-ol |
|---|---|
| PubChem CID | 2303685 |
| Molecular Formula | C21H24ClN2O2+ |
| Molecular Weight | 371.89 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | (2R,3S)-2-(4-chlorophenyl)-1-(4-methoxyphenyl)-3-methyl-5,6,7,8-tetrahydro-3H-imidazo[1,2-a]pyridin-4-ium-2-ol |
| SMILES | COc1ccc(N2C3=[N+](CCCC3)[C@@H](C)[C@]2(O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C21H24ClN2O2/c1-15-21(25,16-6-8-17(22)9-7-16)24(20-5-3-4-14-23(15)20)18-10-12-19(26-2)13-11-18/h6-13,15,25H,3-5,14H2,1-2H3/q+1/t15-,21-/m0/s1 |
| InChIKey | GAIBYRYSJVLECI-BTYIYWSLSA-N |
| XLogP | 4.00 |
| TPSA | 35.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.89 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|