C21H24ClN2O3+ — CID 7031170
(3S)-1-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)-5,6,7,8-tetrahydro-2H-imidazo[1,2-a]pyridin-4-ium-3-ol (PubChem CID 7031170) has the molecular formula C21H24ClN2O3+ and a molecular weight of 387.89 g/mol. Its IUPAC name is (3S)-1-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)-5,6,7,8-tetrahydro-2H-imidazo[1,2-a]pyridin-4-ium-3-ol.
| Compound Name | (3S)-1-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)-5,6,7,8-tetrahydro-2H-imidazo[1,2-a]pyridin-4-ium-3-ol |
|---|---|
| PubChem CID | 7031170 |
| Molecular Formula | C21H24ClN2O3+ |
| Molecular Weight | 387.89 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | (3S)-1-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)-5,6,7,8-tetrahydro-2H-imidazo[1,2-a]pyridin-4-ium-3-ol |
| SMILES | COc1ccc([C@]2(O)CN(c3ccc(Cl)cc3)C3=[N+]2CCCC3)cc1OC |
| InChI | InChI=1S/C21H24ClN2O3/c1-26-18-11-6-15(13-19(18)27-2)21(25)14-23(17-9-7-16(22)8-10-17)20-5-3-4-12-24(20)21/h6-11,13,25H,3-5,12,14H2,1-2H3/q+1/t21-/m1/s1 |
| InChIKey | GHUGHVCXHTWQLC-OAQYLSRUSA-N |
| XLogP | 3.62 |
| TPSA | 44.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.89 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|