C19H21Br2N2O2S+ — CID 126956895
1-(4-bromophenyl)-2-(4-methoxyphenyl)-3,5,6,7-tetrahydroimidazo[2,1-b][1,3]thiazin-4-ium-2-ol;hydrobromide (PubChem CID 126956895) has the molecular formula C19H21Br2N2O2S+ and a molecular weight of 501.26 g/mol. Its IUPAC name is 1-(4-bromophenyl)-2-(4-methoxyphenyl)-3,5,6,7-tetrahydroimidazo[2,1-b][1,3]thiazin-4-ium-2-ol;hydrobromide.
| Compound Name | 1-(4-bromophenyl)-2-(4-methoxyphenyl)-3,5,6,7-tetrahydroimidazo[2,1-b][1,3]thiazin-4-ium-2-ol;hydrobromide |
|---|---|
| PubChem CID | 126956895 |
| Molecular Formula | C19H21Br2N2O2S+ |
| Molecular Weight | 501.26 g/mol |
| Exact Mass | 498.97 |
| IUPAC Name | 1-(4-bromophenyl)-2-(4-methoxyphenyl)-3,5,6,7-tetrahydroimidazo[2,1-b][1,3]thiazin-4-ium-2-ol;hydrobromide |
| SMILES | Br.COc1ccc(C2(O)C[N+]3=C(SCCC3)N2c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C19H20BrN2O2S.BrH/c1-24-17-9-3-14(4-10-17)19(23)13-21-11-2-12-25-18(21)22(19)16-7-5-15(20)6-8-16;/h3-10,23H,2,11-13H2,1H3;1H/q+1; |
| InChIKey | UCTRHQBJSZQBAC-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 35.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.26 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|