C20H23N2O3S+ — CID 7121716
(3R)-1,3-bis(4-methoxyphenyl)-2,5,6,7-tetrahydroimidazo[2,1-b][1,3]thiazin-4-ium-3-ol (PubChem CID 7121716) has the molecular formula C20H23N2O3S+ and a molecular weight of 371.48 g/mol. Its IUPAC name is (3R)-1,3-bis(4-methoxyphenyl)-2,5,6,7-tetrahydroimidazo[2,1-b][1,3]thiazin-4-ium-3-ol.
| Compound Name | (3R)-1,3-bis(4-methoxyphenyl)-2,5,6,7-tetrahydroimidazo[2,1-b][1,3]thiazin-4-ium-3-ol |
|---|---|
| PubChem CID | 7121716 |
| Molecular Formula | C20H23N2O3S+ |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | (3R)-1,3-bis(4-methoxyphenyl)-2,5,6,7-tetrahydroimidazo[2,1-b][1,3]thiazin-4-ium-3-ol |
| SMILES | COc1ccc(N2C[C@](O)(c3ccc(OC)cc3)[N+]3=C2SCCC3)cc1 |
| InChI | InChI=1S/C20H23N2O3S/c1-24-17-8-4-15(5-9-17)20(23)14-21(19-22(20)12-3-13-26-19)16-6-10-18(25-2)11-7-16/h4-11,23H,3,12-14H2,1-2H3/q+1/t20-/m0/s1 |
| InChIKey | ZFQJVQRKLKPQKU-FQEVSTJZSA-N |
| XLogP | 2.87 |
| TPSA | 44.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_imine_ium(2)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|