C19H21N2O3S+ — CID 45135617
5,7-bis(4-methoxyphenyl)-3,6-dihydro-2H-imidazo[2,1-b][1,3]thiazol-4-ium-5-ol (PubChem CID 45135617) has the molecular formula C19H21N2O3S+ and a molecular weight of 357.46 g/mol. Its IUPAC name is 5,7-bis(4-methoxyphenyl)-3,6-dihydro-2H-imidazo[2,1-b][1,3]thiazol-4-ium-5-ol.
| Compound Name | 5,7-bis(4-methoxyphenyl)-3,6-dihydro-2H-imidazo[2,1-b][1,3]thiazol-4-ium-5-ol |
|---|---|
| PubChem CID | 45135617 |
| Molecular Formula | C19H21N2O3S+ |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 5,7-bis(4-methoxyphenyl)-3,6-dihydro-2H-imidazo[2,1-b][1,3]thiazol-4-ium-5-ol |
| SMILES | COc1ccc(N2CC(O)(c3ccc(OC)cc3)[N+]3=C2SCC3)cc1 |
| InChI | InChI=1S/C19H21N2O3S/c1-23-16-7-3-14(4-8-16)19(22)13-20(18-21(19)11-12-25-18)15-5-9-17(24-2)10-6-15/h3-10,22H,11-13H2,1-2H3/q+1 |
| InChIKey | FZTZLYTUPYHILM-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 44.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_imine_ium(2)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|