C17H16Br2N2OS — CID 44788795
7-(4-bromophenyl)-5-phenyl-3,6-dihydro-2H-imidazo[2,1-b][1,3]thiazol-4-ium-5-ol bromide (PubChem CID 44788795) has the molecular formula C17H16Br2N2OS and a molecular weight of 456.20 g/mol. Its IUPAC name is 7-(4-bromophenyl)-5-phenyl-3,6-dihydro-2H-imidazo[2,1-b][1,3]thiazol-4-ium-5-ol bromide.
| Compound Name | 7-(4-bromophenyl)-5-phenyl-3,6-dihydro-2H-imidazo[2,1-b][1,3]thiazol-4-ium-5-ol bromide |
|---|---|
| PubChem CID | 44788795 |
| Molecular Formula | C17H16Br2N2OS |
| Molecular Weight | 456.20 g/mol |
| Exact Mass | 453.94 |
| IUPAC Name | 7-(4-bromophenyl)-5-phenyl-3,6-dihydro-2H-imidazo[2,1-b][1,3]thiazol-4-ium-5-ol bromide |
| SMILES | OC1(c2ccccc2)CN(c2ccc(Br)cc2)C2=[N+]1CCS2.[Br-] |
| InChI | InChI=1S/C17H16BrN2OS.BrH/c18-14-6-8-15(9-7-14)19-12-17(21,13-4-2-1-3-5-13)20-10-11-22-16(19)20;/h1-9,21H,10-12H2;1H/q+1;/p-1 |
| InChIKey | BXQRKHOKVRKRFX-UHFFFAOYSA-M |
| XLogP | 0.23 |
| TPSA | 26.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.20 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_imine_ium(2)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|