C18H18N3O4S+ — CID 45135438
7-(4-methoxyphenyl)-5-(4-nitrophenyl)-3,6-dihydro-2H-imidazo[2,1-b][1,3]thiazol-4-ium-5-ol (PubChem CID 45135438) has the molecular formula C18H18N3O4S+ and a molecular weight of 372.43 g/mol. Its IUPAC name is 7-(4-methoxyphenyl)-5-(4-nitrophenyl)-3,6-dihydro-2H-imidazo[2,1-b][1,3]thiazol-4-ium-5-ol.
| Compound Name | 7-(4-methoxyphenyl)-5-(4-nitrophenyl)-3,6-dihydro-2H-imidazo[2,1-b][1,3]thiazol-4-ium-5-ol |
|---|---|
| PubChem CID | 45135438 |
| Molecular Formula | C18H18N3O4S+ |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | 7-(4-methoxyphenyl)-5-(4-nitrophenyl)-3,6-dihydro-2H-imidazo[2,1-b][1,3]thiazol-4-ium-5-ol |
| SMILES | COc1ccc(N2CC(O)(c3ccc([N+](=O)[O-])cc3)[N+]3=C2SCC3)cc1 |
| InChI | InChI=1S/C18H18N3O4S/c1-25-16-8-6-14(7-9-16)19-12-18(22,20-10-11-26-17(19)20)13-2-4-15(5-3-13)21(23)24/h2-9,22H,10-12H2,1H3/q+1 |
| InChIKey | YJXJSSRBMOIXFC-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_imine_ium(2)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|