C20H21N2O3S+ — CID 980176
(2R)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-phenyl-3,5,6,7-tetrahydroimidazo[2,1-b][1,3]thiazin-4-ium-2-ol (PubChem CID 980176) has the molecular formula C20H21N2O3S+ and a molecular weight of 369.47 g/mol. Its IUPAC name is (2R)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-phenyl-3,5,6,7-tetrahydroimidazo[2,1-b][1,3]thiazin-4-ium-2-ol.
| Compound Name | (2R)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-phenyl-3,5,6,7-tetrahydroimidazo[2,1-b][1,3]thiazin-4-ium-2-ol |
|---|---|
| PubChem CID | 980176 |
| Molecular Formula | C20H21N2O3S+ |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | (2R)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-phenyl-3,5,6,7-tetrahydroimidazo[2,1-b][1,3]thiazin-4-ium-2-ol |
| SMILES | O[C@]1(c2ccc3c(c2)OCCO3)C[N+]2=C(SCCC2)N1c1ccccc1 |
| InChI | InChI=1S/C20H21N2O3S/c23-20(15-7-8-17-18(13-15)25-11-10-24-17)14-21-9-4-12-26-19(21)22(20)16-5-2-1-3-6-16/h1-3,5-8,13,23H,4,9-12,14H2/q+1/t20-/m0/s1 |
| InChIKey | GEAKLJKMRKXCFE-FQEVSTJZSA-N |
| XLogP | 2.63 |
| TPSA | 44.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|