C22H24ClN2O3+ — CID 25273798
(2R)-2-(4-chlorophenyl)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-2-ol (PubChem CID 25273798) has the molecular formula C22H24ClN2O3+ and a molecular weight of 399.90 g/mol. Its IUPAC name is (2R)-2-(4-chlorophenyl)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-2-ol.
| Compound Name | (2R)-2-(4-chlorophenyl)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-2-ol |
|---|---|
| PubChem CID | 25273798 |
| Molecular Formula | C22H24ClN2O3+ |
| Molecular Weight | 399.90 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | (2R)-2-(4-chlorophenyl)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-2-ol |
| SMILES | O[C@]1(c2ccc(Cl)cc2)C[N+]2=C(CCCCC2)N1c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C22H24ClN2O3/c23-17-7-5-16(6-8-17)22(26)15-24-11-3-1-2-4-21(24)25(22)18-9-10-19-20(14-18)28-13-12-27-19/h5-10,14,26H,1-4,11-13,15H2/q+1/t22-/m0/s1 |
| InChIKey | RWYSCRWNFQGXJL-QFIPXVFZSA-N |
| XLogP | 3.76 |
| TPSA | 44.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.90 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|