C19H19F2N2O2S+ — CID 40598309
(2R)-2-[2-(difluoromethoxy)phenyl]-1-phenyl-3,5,6,7-tetrahydroimidazo[2,1-b][1,3]thiazin-4-ium-2-ol (PubChem CID 40598309) has the molecular formula C19H19F2N2O2S+ and a molecular weight of 377.44 g/mol. Its IUPAC name is (2R)-2-[2-(difluoromethoxy)phenyl]-1-phenyl-3,5,6,7-tetrahydroimidazo[2,1-b][1,3]thiazin-4-ium-2-ol.
| Compound Name | (2R)-2-[2-(difluoromethoxy)phenyl]-1-phenyl-3,5,6,7-tetrahydroimidazo[2,1-b][1,3]thiazin-4-ium-2-ol |
|---|---|
| PubChem CID | 40598309 |
| Molecular Formula | C19H19F2N2O2S+ |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | (2R)-2-[2-(difluoromethoxy)phenyl]-1-phenyl-3,5,6,7-tetrahydroimidazo[2,1-b][1,3]thiazin-4-ium-2-ol |
| SMILES | O[C@]1(c2ccccc2OC(F)F)C[N+]2=C(SCCC2)N1c1ccccc1 |
| InChI | InChI=1S/C19H19F2N2O2S/c20-17(21)25-16-10-5-4-9-15(16)19(24)13-22-11-6-12-26-18(22)23(19)14-7-2-1-3-8-14/h1-5,7-10,17,24H,6,11-13H2/q+1/t19-/m0/s1 |
| InChIKey | ZAJCMUDCMFEUJL-IBGZPJMESA-N |
| XLogP | 3.46 |
| TPSA | 35.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|