C21H25BrN2O2 — CID 18553230
3-(4-methoxyphenyl)-1-(2-methylphenyl)-5,6,7,8-tetrahydro-2H-imidazo[1,2-a]pyridin-4-ium-3-ol bromide (PubChem CID 18553230) has the molecular formula C21H25BrN2O2 and a molecular weight of 417.35 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-1-(2-methylphenyl)-5,6,7,8-tetrahydro-2H-imidazo[1,2-a]pyridin-4-ium-3-ol bromide.
| Compound Name | 3-(4-methoxyphenyl)-1-(2-methylphenyl)-5,6,7,8-tetrahydro-2H-imidazo[1,2-a]pyridin-4-ium-3-ol bromide |
|---|---|
| PubChem CID | 18553230 |
| Molecular Formula | C21H25BrN2O2 |
| Molecular Weight | 417.35 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | 3-(4-methoxyphenyl)-1-(2-methylphenyl)-5,6,7,8-tetrahydro-2H-imidazo[1,2-a]pyridin-4-ium-3-ol bromide |
| SMILES | COc1ccc(C2(O)CN(c3ccccc3C)C3=[N+]2CCCC3)cc1.[Br-] |
| InChI | InChI=1S/C21H25N2O2.BrH/c1-16-7-3-4-8-19(16)22-15-21(24,23-14-6-5-9-20(22)23)17-10-12-18(25-2)13-11-17;/h3-4,7-8,10-13,24H,5-6,9,14-15H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | VONBNNZYHZHAQR-UHFFFAOYSA-M |
| XLogP | 0.27 |
| TPSA | 35.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.35 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|