C20H17F4N2O2+ — CID 118985439
1,3-bis[4-(difluoromethoxy)phenyl]-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-4-ium (PubChem CID 118985439) has the molecular formula C20H17F4N2O2+ and a molecular weight of 393.36 g/mol. Its IUPAC name is 1,3-bis[4-(difluoromethoxy)phenyl]-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-4-ium.
| Compound Name | 1,3-bis[4-(difluoromethoxy)phenyl]-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-4-ium |
|---|---|
| PubChem CID | 118985439 |
| Molecular Formula | C20H17F4N2O2+ |
| Molecular Weight | 393.36 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | 1,3-bis[4-(difluoromethoxy)phenyl]-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-4-ium |
| SMILES | FC(F)Oc1ccc(-c2cn(-c3ccc(OC(F)F)cc3)c3[n+]2CCC3)cc1 |
| InChI | InChI=1S/C20H17F4N2O2/c21-19(22)27-15-7-3-13(4-8-15)17-12-26(18-2-1-11-25(17)18)14-5-9-16(10-6-14)28-20(23)24/h3-10,12,19-20H,1-2,11H2/q+1 |
| InChIKey | ALWLZAZCJXKSEQ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 27.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.36 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|