C13H7Cl2F2NO3 — CID 174395103
2-[3,4-dichloro-1-[4-(difluoromethoxy)phenyl]pyrrol-2-yl]-2-oxoacetaldehyde (PubChem CID 174395103) has the molecular formula C13H7Cl2F2NO3 and a molecular weight of 334.11 g/mol. Its IUPAC name is 2-[3,4-dichloro-1-[4-(difluoromethoxy)phenyl]pyrrol-2-yl]-2-oxoacetaldehyde.
| Compound Name | 2-[3,4-dichloro-1-[4-(difluoromethoxy)phenyl]pyrrol-2-yl]-2-oxoacetaldehyde |
|---|---|
| PubChem CID | 174395103 |
| Molecular Formula | C13H7Cl2F2NO3 |
| Molecular Weight | 334.11 g/mol |
| Exact Mass | 332.98 |
| IUPAC Name | 2-[3,4-dichloro-1-[4-(difluoromethoxy)phenyl]pyrrol-2-yl]-2-oxoacetaldehyde |
| SMILES | O=CC(=O)c1c(Cl)c(Cl)cn1-c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C13H7Cl2F2NO3/c14-9-5-18(12(11(9)15)10(20)6-19)7-1-3-8(4-2-7)21-13(16)17/h1-6,13H |
| InChIKey | BXPLTARFHSUTOB-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.11 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|