C15H13ClF2N2O2 — CID 19542952
(E)-3-(4-chloro-1-ethylpyrazol-3-yl)-1-[4-(difluoromethoxy)phenyl]prop-2-en-1-one (PubChem CID 19542952) has the molecular formula C15H13ClF2N2O2 and a molecular weight of 326.73 g/mol. Its IUPAC name is (E)-3-(4-chloro-1-ethylpyrazol-3-yl)-1-[4-(difluoromethoxy)phenyl]prop-2-en-1-one.
| Compound Name | (E)-3-(4-chloro-1-ethylpyrazol-3-yl)-1-[4-(difluoromethoxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19542952 |
| Molecular Formula | C15H13ClF2N2O2 |
| Molecular Weight | 326.73 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | (E)-3-(4-chloro-1-ethylpyrazol-3-yl)-1-[4-(difluoromethoxy)phenyl]prop-2-en-1-one |
| SMILES | CCn1cc(Cl)c(/C=C/C(=O)c2ccc(OC(F)F)cc2)n1 |
| InChI | InChI=1S/C15H13ClF2N2O2/c1-2-20-9-12(16)13(19-20)7-8-14(21)10-3-5-11(6-4-10)22-15(17)18/h3-9,15H,2H2,1H3/b8-7+ |
| InChIKey | MLTAYKRHHOGGLT-BQYQJAHWSA-N |
| XLogP | 4.05 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.73 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|