C16H16F2N4O3 — CID 19412558
4-[[(Z)-3-[4-(difluoromethoxy)phenyl]prop-2-enoyl]amino]-1-ethylpyrazole-3-carboxamide (PubChem CID 19412558) has the molecular formula C16H16F2N4O3 and a molecular weight of 350.33 g/mol. Its IUPAC name is 4-[[(Z)-3-[4-(difluoromethoxy)phenyl]prop-2-enoyl]amino]-1-ethylpyrazole-3-carboxamide.
| Compound Name | 4-[[(Z)-3-[4-(difluoromethoxy)phenyl]prop-2-enoyl]amino]-1-ethylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19412558 |
| Molecular Formula | C16H16F2N4O3 |
| Molecular Weight | 350.33 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 4-[[(Z)-3-[4-(difluoromethoxy)phenyl]prop-2-enoyl]amino]-1-ethylpyrazole-3-carboxamide |
| SMILES | CCn1cc(NC(=O)/C=C\c2ccc(OC(F)F)cc2)c(C(N)=O)n1 |
| InChI | InChI=1S/C16H16F2N4O3/c1-2-22-9-12(14(21-22)15(19)24)20-13(23)8-5-10-3-6-11(7-4-10)25-16(17)18/h3-9,16H,2H2,1H3,(H2,19,24)(H,20,23)/b8-5- |
| InChIKey | UBZXSIMHMCSLSN-YVMONPNESA-N |
| XLogP | 2.26 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.33 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|