C16H16N7O2+ — CID 172952986
2-[(E)-[4-(1-methylimidazo[1,2-a]pyridin-4-ium-2-yl)phenyl]methylideneamino]-1-nitroguanidine (PubChem CID 172952986) has the molecular formula C16H16N7O2+ and a molecular weight of 338.35 g/mol. Its IUPAC name is 2-[(E)-[4-(1-methylimidazo[1,2-a]pyridin-4-ium-2-yl)phenyl]methylideneamino]-1-nitroguanidine.
| Compound Name | 2-[(E)-[4-(1-methylimidazo[1,2-a]pyridin-4-ium-2-yl)phenyl]methylideneamino]-1-nitroguanidine |
|---|---|
| PubChem CID | 172952986 |
| Molecular Formula | C16H16N7O2+ |
| Molecular Weight | 338.35 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 2-[(E)-[4-(1-methylimidazo[1,2-a]pyridin-4-ium-2-yl)phenyl]methylideneamino]-1-nitroguanidine |
| SMILES | Cn1c(-c2ccc(/C=N/N=C(N)N[N+](=O)[O-])cc2)c[n+]2ccccc12 |
| InChI | InChI=1S/C16H16N7O2/c1-21-14(11-22-9-3-2-4-15(21)22)13-7-5-12(6-8-13)10-18-19-16(17)20-23(24)25/h2-11H,1H3,(H3,17,19,20)/q+1/b18-10+ |
| InChIKey | QALIKDXFQVWCTR-VCHYOVAHSA-N |
| XLogP | 0.86 |
| TPSA | 114.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.35 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|