C17H18N7O2+ — CID 46877408
2-[(E)-[4-(1,6-dimethylimidazo[1,2-a]pyridin-4-ium-2-yl)phenyl]methylideneamino]-1-nitroguanidine (PubChem CID 46877408) has the molecular formula C17H18N7O2+ and a molecular weight of 352.38 g/mol. Its IUPAC name is 2-[(E)-[4-(1,6-dimethylimidazo[1,2-a]pyridin-4-ium-2-yl)phenyl]methylideneamino]-1-nitroguanidine.
| Compound Name | 2-[(E)-[4-(1,6-dimethylimidazo[1,2-a]pyridin-4-ium-2-yl)phenyl]methylideneamino]-1-nitroguanidine |
|---|---|
| PubChem CID | 46877408 |
| Molecular Formula | C17H18N7O2+ |
| Molecular Weight | 352.38 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 2-[(E)-[4-(1,6-dimethylimidazo[1,2-a]pyridin-4-ium-2-yl)phenyl]methylideneamino]-1-nitroguanidine |
| SMILES | Cc1ccc2n(C)c(-c3ccc(/C=N/N=C(\N)N[N+](=O)[O-])cc3)c[n+]2c1 |
| InChI | InChI=1S/C17H18N7O2/c1-12-3-8-16-22(2)15(11-23(16)10-12)14-6-4-13(5-7-14)9-19-20-17(18)21-24(25)26/h3-11H,1-2H3,(H3,18,20,21)/q+1/b19-9+ |
| InChIKey | SUDDMZSGEUEDPD-DJKKODMXSA-N |
| XLogP | 1.17 |
| TPSA | 114.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.38 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|