C17H20N6+2 — CID 136795330
amino-[[(2Z)-2-[[4-(1,6-dimethylimidazo[1,2-a]pyridin-4-ium-2-yl)phenyl]methylidene]hydrazinyl]methylidene]azanium (PubChem CID 136795330) has the molecular formula C17H20N6+2 and a molecular weight of 308.39 g/mol. Its IUPAC name is amino-[[(2Z)-2-[[4-(1,6-dimethylimidazo[1,2-a]pyridin-4-ium-2-yl)phenyl]methylidene]hydrazinyl]methylidene]azanium.
| Compound Name | amino-[[(2Z)-2-[[4-(1,6-dimethylimidazo[1,2-a]pyridin-4-ium-2-yl)phenyl]methylidene]hydrazinyl]methylidene]azanium |
|---|---|
| PubChem CID | 136795330 |
| Molecular Formula | C17H20N6+2 |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | amino-[[(2Z)-2-[[4-(1,6-dimethylimidazo[1,2-a]pyridin-4-ium-2-yl)phenyl]methylidene]hydrazinyl]methylidene]azanium |
| SMILES | Cc1ccc2n(C)c(-c3ccc(/C=N\NC=[NH+]N)cc3)c[n+]2c1 |
| InChI | InChI=1S/C17H19N6/c1-13-3-8-17-22(2)16(11-23(17)10-13)15-6-4-14(5-7-15)9-20-21-12-19-18/h3-12H,18H2,1-2H3,(H,19,21)/q+1/p+1/b20-9- |
| InChIKey | VWXARQPUPQWRAY-UKWGHVSLSA-O |
| XLogP | -0.35 |
| TPSA | 73.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|