C14H20N6O+2 — CID 136795343
amino-[[(2Z)-2-[[4-[(1,3-dimethylimidazol-1-ium-2-yl)methoxy]phenyl]methylidene]hydrazinyl]methylidene]azanium (PubChem CID 136795343) has the molecular formula C14H20N6O+2 and a molecular weight of 288.36 g/mol. Its IUPAC name is amino-[[(2Z)-2-[[4-[(1,3-dimethylimidazol-1-ium-2-yl)methoxy]phenyl]methylidene]hydrazinyl]methylidene]azanium.
| Compound Name | amino-[[(2Z)-2-[[4-[(1,3-dimethylimidazol-1-ium-2-yl)methoxy]phenyl]methylidene]hydrazinyl]methylidene]azanium |
|---|---|
| PubChem CID | 136795343 |
| Molecular Formula | C14H20N6O+2 |
| Molecular Weight | 288.36 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | amino-[[(2Z)-2-[[4-[(1,3-dimethylimidazol-1-ium-2-yl)methoxy]phenyl]methylidene]hydrazinyl]methylidene]azanium |
| SMILES | Cn1cc[n+](C)c1COc1ccc(/C=N\NC=[NH+]N)cc1 |
| InChI | InChI=1S/C14H19N6O/c1-19-7-8-20(2)14(19)10-21-13-5-3-12(4-6-13)9-17-18-11-16-15/h3-9,11H,10,15H2,1-2H3,(H,16,18)/q+1/p+1/b17-9- |
| InChIKey | SHDFDWSFAWQLCB-MFOYZWKCSA-O |
| XLogP | -1.67 |
| TPSA | 82.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.36 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|