C17H23Br2N5O — CID 53319086
2-ethyl-1-[(E)-[4-[(1-methylpyridin-1-ium-2-yl)methoxy]phenyl]methylideneamino]guanidine;bromide;hydrobromide (PubChem CID 53319086) has the molecular formula C17H23Br2N5O and a molecular weight of 473.21 g/mol. Its IUPAC name is 2-ethyl-1-[(E)-[4-[(1-methylpyridin-1-ium-2-yl)methoxy]phenyl]methylideneamino]guanidine;bromide;hydrobromide.
| Compound Name | 2-ethyl-1-[(E)-[4-[(1-methylpyridin-1-ium-2-yl)methoxy]phenyl]methylideneamino]guanidine;bromide;hydrobromide |
|---|---|
| PubChem CID | 53319086 |
| Molecular Formula | C17H23Br2N5O |
| Molecular Weight | 473.21 g/mol |
| Exact Mass | 471.03 |
| IUPAC Name | 2-ethyl-1-[(E)-[4-[(1-methylpyridin-1-ium-2-yl)methoxy]phenyl]methylideneamino]guanidine;bromide;hydrobromide |
| SMILES | Br.CC/N=C(\N)N/N=C/c1ccc(OCc2cccc[n+]2C)cc1.[Br-] |
| InChI | InChI=1S/C17H22N5O.2BrH/c1-3-19-17(18)21-20-12-14-7-9-16(10-8-14)23-13-15-6-4-5-11-22(15)2;;/h4-12H,3,13H2,1-2H3,(H3,18,19,21);2*1H/q+1;;/p-1/b20-12+;; |
| InChIKey | OWCLHYFMQVJEQB-FPIMHUBQSA-M |
| XLogP | -1.07 |
| TPSA | 75.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.21 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|