C32H40N6O7S2 — CID 118705532
N'-[(E)-[4-[(1,3-dimethylimidazol-1-ium-2-yl)methoxy]phenyl]methylideneamino]pyrrolidine-1-carboximidamide;4-methylbenzenesulfonate;4-methylbenzenesulfonic acid (PubChem CID 118705532) has the molecular formula C32H40N6O7S2 and a molecular weight of 684.84 g/mol. Its IUPAC name is N'-[(E)-[4-[(1,3-dimethylimidazol-1-ium-2-yl)methoxy]phenyl]methylideneamino]pyrrolidine-1-carboximidamide;4-methylbenzenesulfonate;4-methylbenzenesulfonic acid.
| Compound Name | N'-[(E)-[4-[(1,3-dimethylimidazol-1-ium-2-yl)methoxy]phenyl]methylideneamino]pyrrolidine-1-carboximidamide;4-methylbenzenesulfonate;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 118705532 |
| Molecular Formula | C32H40N6O7S2 |
| Molecular Weight | 684.84 g/mol |
| Exact Mass | 684.24 |
| IUPAC Name | N'-[(E)-[4-[(1,3-dimethylimidazol-1-ium-2-yl)methoxy]phenyl]methylideneamino]pyrrolidine-1-carboximidamide;4-methylbenzenesulfonate;4-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.Cc1ccc(S(=O)(=O)[O-])cc1.Cn1cc[n+](C)c1COc1ccc(/C=N/N=C(/N)N2CCCC2)cc1 |
| InChI | InChI=1S/C18H25N6O.2C7H8O3S/c1-22-11-12-23(2)17(22)14-25-16-7-5-15(6-8-16)13-20-21-18(19)24-9-3-4-10-24;2*1-6-2-4-7(5-3-6)11(8,9)10/h5-8,11-13H,3-4,9-10,14H2,1-2H3,(H2,19,21);2*2-5H,1H3,(H,8,9,10)/q+1;;/p-1/b20-13+;; |
| InChIKey | HQYAJBXKTUXGNI-KMLWPLPUSA-M |
| XLogP | 3.31 |
| TPSA | 183.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.84 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|