C22H24F3N6O+ — CID 172923250
N'-[(E)-[4-[[1-methyl-6-(trifluoromethyl)imidazo[1,2-a]pyridin-4-ium-2-yl]methoxy]phenyl]methylideneamino]pyrrolidine-1-carboximidamide (PubChem CID 172923250) has the molecular formula C22H24F3N6O+ and a molecular weight of 445.47 g/mol. Its IUPAC name is N'-[(E)-[4-[[1-methyl-6-(trifluoromethyl)imidazo[1,2-a]pyridin-4-ium-2-yl]methoxy]phenyl]methylideneamino]pyrrolidine-1-carboximidamide.
| Compound Name | N'-[(E)-[4-[[1-methyl-6-(trifluoromethyl)imidazo[1,2-a]pyridin-4-ium-2-yl]methoxy]phenyl]methylideneamino]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 172923250 |
| Molecular Formula | C22H24F3N6O+ |
| Molecular Weight | 445.47 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | N'-[(E)-[4-[[1-methyl-6-(trifluoromethyl)imidazo[1,2-a]pyridin-4-ium-2-yl]methoxy]phenyl]methylideneamino]pyrrolidine-1-carboximidamide |
| SMILES | Cn1c(COc2ccc(/C=N/N=C(N)N3CCCC3)cc2)c[n+]2cc(C(F)(F)F)ccc12 |
| InChI | InChI=1S/C22H24F3N6O/c1-29-18(14-31-13-17(22(23,24)25)6-9-20(29)31)15-32-19-7-4-16(5-8-19)12-27-28-21(26)30-10-2-3-11-30/h4-9,12-14H,2-3,10-11,15H2,1H3,(H2,26,28)/q+1/b27-12+ |
| InChIKey | XVENMPJJGQWYDI-KKMKTNMSSA-N |
| XLogP | 3.11 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.47 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|