C40H36N8O4+2 — CID 5478087
1-N,3-N-bis[(Z)-[4-[(1-methylimidazo[1,2-a]pyridin-4-ium-2-yl)methoxy]phenyl]methylideneamino]benzene-1,3-dicarboxamide (PubChem CID 5478087) has the molecular formula C40H36N8O4+2 and a molecular weight of 692.78 g/mol. Its IUPAC name is 1-N,3-N-bis[(Z)-[4-[(1-methylimidazo[1,2-a]pyridin-4-ium-2-yl)methoxy]phenyl]methylideneamino]benzene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis[(Z)-[4-[(1-methylimidazo[1,2-a]pyridin-4-ium-2-yl)methoxy]phenyl]methylideneamino]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 5478087 |
| Molecular Formula | C40H36N8O4+2 |
| Molecular Weight | 692.78 g/mol |
| Exact Mass | 692.28 |
| IUPAC Name | 1-N,3-N-bis[(Z)-[4-[(1-methylimidazo[1,2-a]pyridin-4-ium-2-yl)methoxy]phenyl]methylideneamino]benzene-1,3-dicarboxamide |
| SMILES | Cn1c(COc2ccc(/C=N\NC(=O)c3cccc(C(=O)N/N=C\c4ccc(OCc5c[n+]6ccccc6n5C)cc4)c3)cc2)c[n+]2ccccc12 |
| InChI | InChI=1S/C40H34N8O4/c1-45-33(25-47-20-5-3-10-37(45)47)27-51-35-16-12-29(13-17-35)23-41-43-39(49)31-8-7-9-32(22-31)40(50)44-42-24-30-14-18-36(19-15-30)52-28-34-26-48-21-6-4-11-38(48)46(34)2/h3-26H,27-28H2,1-2H3/p+2/b41-23-,42-24- |
| InChIKey | AOXPTUJKPQEOPV-GVRDMIKJSA-P |
| XLogP | 4.53 |
| TPSA | 119.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.78 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|