C17H20Br2N6O2 — CID 53318129
1-hydroxy-2-[(E)-[4-[(1-methylimidazo[1,2-a]pyridin-4-ium-2-yl)methoxy]phenyl]methylideneamino]guanidine;bromide;hydrobromide (PubChem CID 53318129) has the molecular formula C17H20Br2N6O2 and a molecular weight of 500.20 g/mol. Its IUPAC name is 1-hydroxy-2-[(E)-[4-[(1-methylimidazo[1,2-a]pyridin-4-ium-2-yl)methoxy]phenyl]methylideneamino]guanidine;bromide;hydrobromide.
| Compound Name | 1-hydroxy-2-[(E)-[4-[(1-methylimidazo[1,2-a]pyridin-4-ium-2-yl)methoxy]phenyl]methylideneamino]guanidine;bromide;hydrobromide |
|---|---|
| PubChem CID | 53318129 |
| Molecular Formula | C17H20Br2N6O2 |
| Molecular Weight | 500.20 g/mol |
| Exact Mass | 498.00 |
| IUPAC Name | 1-hydroxy-2-[(E)-[4-[(1-methylimidazo[1,2-a]pyridin-4-ium-2-yl)methoxy]phenyl]methylideneamino]guanidine;bromide;hydrobromide |
| SMILES | Br.Cn1c(COc2ccc(/C=N/N=C(\N)NO)cc2)c[n+]2ccccc12.[Br-] |
| InChI | InChI=1S/C17H19N6O2.2BrH/c1-22-14(11-23-9-3-2-4-16(22)23)12-25-15-7-5-13(6-8-15)10-19-20-17(18)21-24;;/h2-11,24H,12H2,1H3,(H3,18,20,21);2*1H/q+1;;/p-1/b19-10+;; |
| InChIKey | JBCXFOOWOKRBIA-DLFBYYCRSA-M |
| XLogP | -1.45 |
| TPSA | 101.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.20 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|