C22H28Br2N6O — CID 172923251
N'-[(E)-[4-[(1,6-dimethylimidazo[1,2-a]pyridin-4-ium-2-yl)methoxy]phenyl]methylideneamino]pyrrolidine-1-carboximidamide;bromide;hydrobromide (PubChem CID 172923251) has the molecular formula C22H28Br2N6O and a molecular weight of 552.32 g/mol. Its IUPAC name is N'-[(E)-[4-[(1,6-dimethylimidazo[1,2-a]pyridin-4-ium-2-yl)methoxy]phenyl]methylideneamino]pyrrolidine-1-carboximidamide;bromide;hydrobromide.
| Compound Name | N'-[(E)-[4-[(1,6-dimethylimidazo[1,2-a]pyridin-4-ium-2-yl)methoxy]phenyl]methylideneamino]pyrrolidine-1-carboximidamide;bromide;hydrobromide |
|---|---|
| PubChem CID | 172923251 |
| Molecular Formula | C22H28Br2N6O |
| Molecular Weight | 552.32 g/mol |
| Exact Mass | 550.07 |
| IUPAC Name | N'-[(E)-[4-[(1,6-dimethylimidazo[1,2-a]pyridin-4-ium-2-yl)methoxy]phenyl]methylideneamino]pyrrolidine-1-carboximidamide;bromide;hydrobromide |
| SMILES | Br.Cc1ccc2n(C)c(COc3ccc(/C=N/N=C(N)N4CCCC4)cc3)c[n+]2c1.[Br-] |
| InChI | InChI=1S/C22H27N6O.2BrH/c1-17-5-10-21-26(2)19(15-28(21)14-17)16-29-20-8-6-18(7-9-20)13-24-25-22(23)27-11-3-4-12-27;;/h5-10,13-15H,3-4,11-12,16H2,1-2H3,(H2,23,25);2*1H/q+1;;/p-1/b24-13+;; |
| InChIKey | RGOXNWRFTCNDBY-QWCQITGJSA-M |
| XLogP | -0.02 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.32 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|