C17H19N6O2+ — CID 53318130
1-hydroxy-2-[(E)-[4-[(1-methylimidazo[1,2-a]pyridin-4-ium-2-yl)methoxy]phenyl]methylideneamino]guanidine (PubChem CID 53318130) has the molecular formula C17H19N6O2+ and a molecular weight of 339.38 g/mol. Its IUPAC name is 1-hydroxy-2-[(E)-[4-[(1-methylimidazo[1,2-a]pyridin-4-ium-2-yl)methoxy]phenyl]methylideneamino]guanidine.
| Compound Name | 1-hydroxy-2-[(E)-[4-[(1-methylimidazo[1,2-a]pyridin-4-ium-2-yl)methoxy]phenyl]methylideneamino]guanidine |
|---|---|
| PubChem CID | 53318130 |
| Molecular Formula | C17H19N6O2+ |
| Molecular Weight | 339.38 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 1-hydroxy-2-[(E)-[4-[(1-methylimidazo[1,2-a]pyridin-4-ium-2-yl)methoxy]phenyl]methylideneamino]guanidine |
| SMILES | Cn1c(COc2ccc(/C=N/N=C(\N)NO)cc2)c[n+]2ccccc12 |
| InChI | InChI=1S/C17H19N6O2/c1-22-14(11-23-9-3-2-4-16(22)23)12-25-15-7-5-13(6-8-15)10-19-20-17(18)21-24/h2-11,24H,12H2,1H3,(H3,18,20,21)/q+1/b19-10+ |
| InChIKey | KDMWXSYRFBKYRX-VXLYETTFSA-N |
| XLogP | 0.97 |
| TPSA | 101.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.38 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|