C15H20Br2N6O — CID 172986417
2-[(E)-[4-[(E)-2-(1,3-dimethylimidazol-1-ium-2-yl)ethenyl]phenyl]methylideneamino]-1-hydroxyguanidine;bromide;hydrobromide (PubChem CID 172986417) has the molecular formula C15H20Br2N6O and a molecular weight of 460.17 g/mol. Its IUPAC name is 2-[(E)-[4-[(E)-2-(1,3-dimethylimidazol-1-ium-2-yl)ethenyl]phenyl]methylideneamino]-1-hydroxyguanidine;bromide;hydrobromide.
| Compound Name | 2-[(E)-[4-[(E)-2-(1,3-dimethylimidazol-1-ium-2-yl)ethenyl]phenyl]methylideneamino]-1-hydroxyguanidine;bromide;hydrobromide |
|---|---|
| PubChem CID | 172986417 |
| Molecular Formula | C15H20Br2N6O |
| Molecular Weight | 460.17 g/mol |
| Exact Mass | 458.01 |
| IUPAC Name | 2-[(E)-[4-[(E)-2-(1,3-dimethylimidazol-1-ium-2-yl)ethenyl]phenyl]methylideneamino]-1-hydroxyguanidine;bromide;hydrobromide |
| SMILES | Br.Cn1cc[n+](C)c1/C=C/c1ccc(/C=N/N=C(N)NO)cc1.[Br-] |
| InChI | InChI=1S/C15H18N6O.2BrH/c1-20-9-10-21(2)14(20)8-7-12-3-5-13(6-4-12)11-17-18-15(16)19-22;;/h3-11H,1-2H3,(H3,16,17,18,19,22);2*1H |
| InChIKey | QOWRUPKQYVFCCE-UHFFFAOYSA-N |
| XLogP | -1.77 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.17 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|