About trisodium;2-methoxy-5-nitrophenolate;2-nitrophenolate;4-nitrophenolate
trisodium;2-methoxy-5-nitrophenolate;2-nitrophenolate;4-nitrophenolate (PubChem CID 163444497) has the molecular formula C19H14N3Na3O10
and a molecular weight of 513.30 g/mol. Its IUPAC name is trisodium;2-methoxy-5-nitrophenolate;2-nitrophenolate;4-nitrophenolate.
Molecular Properties
| Compound Name | trisodium;2-methoxy-5-nitrophenolate;2-nitrophenolate;4-nitrophenolate |
| PubChem CID | 163444497 |
| Molecular Formula | C19H14N3Na3O10 |
| Molecular Weight | 513.30 g/mol |
| Exact Mass | 513.04 |
| IUPAC Name | trisodium;2-methoxy-5-nitrophenolate;2-nitrophenolate;4-nitrophenolate |
| SMILES | COc1ccc([N+](=O)[O-])cc1[O-].O=[N+]([O-])c1ccc([O-])cc1.O=[N+]([O-])c1ccccc1[O-].[Na+].[Na+].[Na+] |
| InChI | InChI=1S/C7H7NO4.2C6H5NO3.3Na/c1-12-7-3-2-5(8(10)11)4-6(7)9;8-6-3-1-5(2-4-6)7(9)10;8-6-4-2-1-3-5(6)7(9)10;;;/h2-4,9H,1H3;2*1-4,8H;;;/q;;;3*+1/p-3 |
| InChIKey | DLZGOEDNHZCMAX-UHFFFAOYSA-K |
| XLogP | -6.97 |
| TPSA | 207.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 513.30 |
| LogP ≤ 5 | -6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze trisodium;2-methoxy-5-nitrophenolate;2-nitrophenolate;4-nitrophenolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trisodium;2-methoxy-5-nitrophenolate;2-nitrophenolate;4-nitrophenolate?
The IUPAC name of trisodium;2-methoxy-5-nitrophenolate;2-nitrophenolate;4-nitrophenolate (CID 163444497) is trisodium;2-methoxy-5-nitrophenolate;2-nitrophenolate;4-nitrophenolate.
What is the SMILES notation for trisodium;2-methoxy-5-nitrophenolate;2-nitrophenolate;4-nitrophenolate?
The canonical SMILES for trisodium;2-methoxy-5-nitrophenolate;2-nitrophenolate;4-nitrophenolate is COc1ccc([N+](=O)[O-])cc1[O-].O=[N+]([O-])c1ccc([O-])cc1.O=[N+]([O-])c1ccccc1[O-].[Na+].[Na+].[Na+].
What is the InChIKey of trisodium;2-methoxy-5-nitrophenolate;2-nitrophenolate;4-nitrophenolate?
The InChIKey is DLZGOEDNHZCMAX-UHFFFAOYSA-K. The full InChI is InChI=1S/C7H7NO4.2C6H5NO3.3Na/c1-12-7-3-2-5(8(10)11)4-6(7)9;8-6-3-1-5(2-4-6)7(9)10;8-6-4-2-1-3-5(6)7(9)10;;;/h2-4,9H,1H3;2*1-4,8H;;;/q;;;3*+1/p-3.
What are the key properties of trisodium;2-methoxy-5-nitrophenolate;2-nitrophenolate;4-nitrophenolate?
trisodium;2-methoxy-5-nitrophenolate;2-nitrophenolate;4-nitrophenolate has a molecular weight of 513.30 g/mol, XLogP of -6.97, 4 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for trisodium;2-methoxy-5-nitrophenolate;2-nitrophenolate;4-nitrophenolate is sourced from PubChem (CID 163444497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).