C15H16N2O4 — CID 88735463
1-methyl-2,4-dinitrobenzene;1,2-xylene (PubChem CID 88735463) has the molecular formula C15H16N2O4 and a molecular weight of 288.30 g/mol. Its IUPAC name is 1-methyl-2,4-dinitrobenzene;1,2-xylene.
| Compound Name | 1-methyl-2,4-dinitrobenzene;1,2-xylene |
|---|---|
| PubChem CID | 88735463 |
| Molecular Formula | C15H16N2O4 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 1-methyl-2,4-dinitrobenzene;1,2-xylene |
| SMILES | Cc1ccc([N+](=O)[O-])cc1[N+](=O)[O-].Cc1ccccc1C |
| InChI | InChI=1S/C8H10.C7H6N2O4/c1-7-5-3-4-6-8(7)2;1-5-2-3-6(8(10)11)4-7(5)9(12)13/h3-6H,1-2H3;2-4H,1H3 |
| InChIKey | SEGFLPLCVNWDPP-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|