C13H14BrN4O4+ — CID 159852503
5-bromo-2-methylpyridin-1-ium-1-amine;1-methyl-2,4-dinitrobenzene (PubChem CID 159852503) has the molecular formula C13H14BrN4O4+ and a molecular weight of 370.18 g/mol. Its IUPAC name is 5-bromo-2-methylpyridin-1-ium-1-amine;1-methyl-2,4-dinitrobenzene.
| Compound Name | 5-bromo-2-methylpyridin-1-ium-1-amine;1-methyl-2,4-dinitrobenzene |
|---|---|
| PubChem CID | 159852503 |
| Molecular Formula | C13H14BrN4O4+ |
| Molecular Weight | 370.18 g/mol |
| Exact Mass | 369.02 |
| IUPAC Name | 5-bromo-2-methylpyridin-1-ium-1-amine;1-methyl-2,4-dinitrobenzene |
| SMILES | Cc1ccc(Br)c[n+]1N.Cc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H6N2O4.C6H8BrN2/c1-5-2-3-6(8(10)11)4-7(5)9(12)13;1-5-2-3-6(7)4-9(5)8/h2-4H,1H3;2-4H,8H2,1H3/q;+1 |
| InChIKey | NQCQQNFFWPEUSP-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 116.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.18 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|