C13H9N3O6S — CID 57359203
4-(2,4-dinitrophenyl)sulfanyl-1-methyl-2-nitrobenzene (PubChem CID 57359203) has the molecular formula C13H9N3O6S and a molecular weight of 335.30 g/mol. Its IUPAC name is 4-(2,4-dinitrophenyl)sulfanyl-1-methyl-2-nitrobenzene.
| Compound Name | 4-(2,4-dinitrophenyl)sulfanyl-1-methyl-2-nitrobenzene |
|---|---|
| PubChem CID | 57359203 |
| Molecular Formula | C13H9N3O6S |
| Molecular Weight | 335.30 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | 4-(2,4-dinitrophenyl)sulfanyl-1-methyl-2-nitrobenzene |
| SMILES | Cc1ccc(Sc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H9N3O6S/c1-8-2-4-10(7-11(8)15(19)20)23-13-5-3-9(14(17)18)6-12(13)16(21)22/h2-7H,1H3 |
| InChIKey | JHQJBEHDBUQGOI-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 129.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.30 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|