C9H8N2O2 — CID 155291368
8-nitro-3,4-dihydroisoquinoline (PubChem CID 155291368) has the molecular formula C9H8N2O2 and a molecular weight of 176.18 g/mol. Its IUPAC name is 8-nitro-3,4-dihydroisoquinoline.
| Compound Name | 8-nitro-3,4-dihydroisoquinoline |
|---|---|
| PubChem CID | 155291368 |
| Molecular Formula | C9H8N2O2 |
| Molecular Weight | 176.18 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | 8-nitro-3,4-dihydroisoquinoline |
| SMILES | O=[N+]([O-])c1cccc2c1C=NCC2 |
| InChI | InChI=1S/C9H8N2O2/c12-11(13)9-3-1-2-7-4-5-10-6-8(7)9/h1-3,6H,4-5H2 |
| InChIKey | SDYSBCONQVLWLW-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 55.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.18 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|