C9H9NO3S — CID 130137675
8-nitro-3,4-dihydro-2H-thiochromen-4-ol (PubChem CID 130137675) has the molecular formula C9H9NO3S and a molecular weight of 211.24 g/mol. Its IUPAC name is 8-nitro-3,4-dihydro-2H-thiochromen-4-ol.
| Compound Name | 8-nitro-3,4-dihydro-2H-thiochromen-4-ol |
|---|---|
| PubChem CID | 130137675 |
| Molecular Formula | C9H9NO3S |
| Molecular Weight | 211.24 g/mol |
| Exact Mass | 211.03 |
| IUPAC Name | 8-nitro-3,4-dihydro-2H-thiochromen-4-ol |
| SMILES | O=[N+]([O-])c1cccc2c1SCCC2O |
| InChI | InChI=1S/C9H9NO3S/c11-8-4-5-14-9-6(8)2-1-3-7(9)10(12)13/h1-3,8,11H,4-5H2 |
| InChIKey | BDCYSKRIJIGPJW-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.24 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|