C12H9F2NO2 — CID 16679384
11-(difluoromethylidene)-3-nitrotricyclo[6.2.1.02,7]undeca-2(7),3,5-triene (PubChem CID 16679384) has the molecular formula C12H9F2NO2 and a molecular weight of 237.20 g/mol. Its IUPAC name is 11-(difluoromethylidene)-3-nitrotricyclo[6.2.1.02,7]undeca-2(7),3,5-triene.
| Compound Name | 11-(difluoromethylidene)-3-nitrotricyclo[6.2.1.02,7]undeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 16679384 |
| Molecular Formula | C12H9F2NO2 |
| Molecular Weight | 237.20 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 11-(difluoromethylidene)-3-nitrotricyclo[6.2.1.02,7]undeca-2(7),3,5-triene |
| SMILES | O=[N+]([O-])c1cccc2c1C1CCC2C1=C(F)F |
| InChI | InChI=1S/C12H9F2NO2/c13-12(14)11-7-4-5-8(11)10-6(7)2-1-3-9(10)15(16)17/h1-3,7-8H,4-5H2 |
| InChIKey | NUUHPWBOBYKPJK-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.20 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|