C12H7Br2NO2 — CID 15353330
(1S,2S)-1,2-dibromo-3-nitro-1,2-dihydroacenaphthylene (PubChem CID 15353330) has the molecular formula C12H7Br2NO2 and a molecular weight of 357.00 g/mol. Its IUPAC name is (1S,2S)-1,2-dibromo-3-nitro-1,2-dihydroacenaphthylene.
| Compound Name | (1S,2S)-1,2-dibromo-3-nitro-1,2-dihydroacenaphthylene |
|---|---|
| PubChem CID | 15353330 |
| Molecular Formula | C12H7Br2NO2 |
| Molecular Weight | 357.00 g/mol |
| Exact Mass | 354.88 |
| IUPAC Name | (1S,2S)-1,2-dibromo-3-nitro-1,2-dihydroacenaphthylene |
| SMILES | O=[N+]([O-])c1ccc2cccc3c2c1[C@H](Br)[C@H]3Br |
| InChI | InChI=1S/C12H7Br2NO2/c13-11-7-3-1-2-6-4-5-8(15(16)17)10(9(6)7)12(11)14/h1-5,11-12H/t11-,12-/m0/s1 |
| InChIKey | PYJZPTFFAXUEMY-RYUDHWBXSA-N |
| XLogP | 4.63 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.00 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|