C20H11N3O6 — CID 23660787
3,11,18-trinitropentacyclo[6.6.6.02,7.09,14.015,20]icosa-2(7),3,5,9(14),10,12,15(20),16,18-nonaene (PubChem CID 23660787) has the molecular formula C20H11N3O6 and a molecular weight of 389.32 g/mol. Its IUPAC name is 3,11,18-trinitropentacyclo[6.6.6.02,7.09,14.015,20]icosa-2(7),3,5,9(14),10,12,15(20),16,18-nonaene.
| Compound Name | 3,11,18-trinitropentacyclo[6.6.6.02,7.09,14.015,20]icosa-2(7),3,5,9(14),10,12,15(20),16,18-nonaene |
|---|---|
| PubChem CID | 23660787 |
| Molecular Formula | C20H11N3O6 |
| Molecular Weight | 389.32 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | 3,11,18-trinitropentacyclo[6.6.6.02,7.09,14.015,20]icosa-2(7),3,5,9(14),10,12,15(20),16,18-nonaene |
| SMILES | O=[N+]([O-])c1ccc2c(c1)C1c3cc([N+](=O)[O-])ccc3C2c2c1cccc2[N+](=O)[O-] |
| InChI | InChI=1S/C20H11N3O6/c24-21(25)10-4-6-12-15(8-10)18-14-2-1-3-17(23(28)29)20(14)19(12)13-7-5-11(22(26)27)9-16(13)18/h1-9,18-19H |
| InChIKey | PGSHRCFSNGMLMW-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 129.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.32 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|