C20H14N2O2 — CID 23660786
5-nitropentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,4,6,9,11,13,15,17,19-nonaen-4-amine (PubChem CID 23660786) has the molecular formula C20H14N2O2 and a molecular weight of 314.34 g/mol. Its IUPAC name is 5-nitropentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,4,6,9,11,13,15,17,19-nonaen-4-amine.
| Compound Name | 5-nitropentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,4,6,9,11,13,15,17,19-nonaen-4-amine |
|---|---|
| PubChem CID | 23660786 |
| Molecular Formula | C20H14N2O2 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 5-nitropentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,4,6,9,11,13,15,17,19-nonaen-4-amine |
| SMILES | Nc1cc2c(cc1[N+](=O)[O-])C1c3ccccc3C2c2ccccc21 |
| InChI | InChI=1S/C20H14N2O2/c21-17-9-15-16(10-18(17)22(23)24)20-13-7-3-1-5-11(13)19(15)12-6-2-4-8-14(12)20/h1-10,19-20H,21H2 |
| InChIKey | ALKSFCRKENAOFQ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|