C14H15NO2 — CID 66686342
3-nitro-10-propan-2-yltricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraene (PubChem CID 66686342) has the molecular formula C14H15NO2 and a molecular weight of 229.28 g/mol. Its IUPAC name is 3-nitro-10-propan-2-yltricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraene.
| Compound Name | 3-nitro-10-propan-2-yltricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraene |
|---|---|
| PubChem CID | 66686342 |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 3-nitro-10-propan-2-yltricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraene |
| SMILES | CC(C)C1=CC2CC1c1c2cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H15NO2/c1-8(2)11-6-9-7-12(11)14-10(9)4-3-5-13(14)15(16)17/h3-6,8-9,12H,7H2,1-2H3 |
| InChIKey | VMGDJFFEGYWMCU-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|