C11H14N2O2 — CID 124680905
(3S)-7-nitro-3-propan-2-yl-2,3-dihydro-1H-indole (PubChem CID 124680905) has the molecular formula C11H14N2O2 and a molecular weight of 206.25 g/mol. Its IUPAC name is (3S)-7-nitro-3-propan-2-yl-2,3-dihydro-1H-indole.
| Compound Name | (3S)-7-nitro-3-propan-2-yl-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 124680905 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | (3S)-7-nitro-3-propan-2-yl-2,3-dihydro-1H-indole |
| SMILES | CC(C)[C@@H]1CNc2c1cccc2[N+](=O)[O-] |
| InChI | InChI=1S/C11H14N2O2/c1-7(2)9-6-12-11-8(9)4-3-5-10(11)13(14)15/h3-5,7,9,12H,6H2,1-2H3/t9-/m0/s1 |
| InChIKey | KMTDIOJPLANYOT-VIFPVBQESA-N |
| XLogP | 2.76 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|