C11H13N3O2 — CID 135526954
3,5-dimethyl-9-nitro-2,3-dihydro-1H-1,4-benzodiazepine (PubChem CID 135526954) has the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. Its IUPAC name is 3,5-dimethyl-9-nitro-2,3-dihydro-1H-1,4-benzodiazepine.
| Compound Name | 3,5-dimethyl-9-nitro-2,3-dihydro-1H-1,4-benzodiazepine |
|---|---|
| PubChem CID | 135526954 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 3,5-dimethyl-9-nitro-2,3-dihydro-1H-1,4-benzodiazepine |
| SMILES | CC1=NC(C)CNc2c1cccc2[N+](=O)[O-] |
| InChI | InChI=1S/C11H13N3O2/c1-7-6-12-11-9(8(2)13-7)4-3-5-10(11)14(15)16/h3-5,7,12H,6H2,1-2H3 |
| InChIKey | BERAHBKJJNTPJD-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 67.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|