C13H13N3O2 — CID 137187505
1,3-dimethyl-8-nitro-4,9-dihydro-3H-pyrido[3,4-b]indole (PubChem CID 137187505) has the molecular formula C13H13N3O2 and a molecular weight of 243.27 g/mol. Its IUPAC name is 1,3-dimethyl-8-nitro-4,9-dihydro-3H-pyrido[3,4-b]indole.
| Compound Name | 1,3-dimethyl-8-nitro-4,9-dihydro-3H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 137187505 |
| Molecular Formula | C13H13N3O2 |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 1,3-dimethyl-8-nitro-4,9-dihydro-3H-pyrido[3,4-b]indole |
| SMILES | CC1=NC(C)Cc2c1[nH]c1c([N+](=O)[O-])cccc21 |
| InChI | InChI=1S/C13H13N3O2/c1-7-6-10-9-4-3-5-11(16(17)18)13(9)15-12(10)8(2)14-7/h3-5,7,15H,6H2,1-2H3 |
| InChIKey | SUFHCIKXMFYKGH-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 71.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|