C9H10N2O4 — CID 83820748
(5-nitro-3,4-dihydro-2H-1,4-benzoxazin-2-yl)methanol (PubChem CID 83820748) has the molecular formula C9H10N2O4 and a molecular weight of 210.19 g/mol. Its IUPAC name is (5-nitro-3,4-dihydro-2H-1,4-benzoxazin-2-yl)methanol.
| Compound Name | (5-nitro-3,4-dihydro-2H-1,4-benzoxazin-2-yl)methanol |
|---|---|
| PubChem CID | 83820748 |
| Molecular Formula | C9H10N2O4 |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | (5-nitro-3,4-dihydro-2H-1,4-benzoxazin-2-yl)methanol |
| SMILES | O=[N+]([O-])c1cccc2c1NCC(CO)O2 |
| InChI | InChI=1S/C9H10N2O4/c12-5-6-4-10-9-7(11(13)14)2-1-3-8(9)15-6/h1-3,6,10,12H,4-5H2 |
| InChIKey | VRJNGVMMEXUZBD-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 84.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|