C16H14N2O5 — CID 99628312
N-[[(2S)-2,3-dihydro-1-benzofuran-2-yl]methyl]-2-hydroxy-3-nitrobenzamide (PubChem CID 99628312) has the molecular formula C16H14N2O5 and a molecular weight of 314.30 g/mol. Its IUPAC name is N-[[(2S)-2,3-dihydro-1-benzofuran-2-yl]methyl]-2-hydroxy-3-nitrobenzamide.
| Compound Name | N-[[(2S)-2,3-dihydro-1-benzofuran-2-yl]methyl]-2-hydroxy-3-nitrobenzamide |
|---|---|
| PubChem CID | 99628312 |
| Molecular Formula | C16H14N2O5 |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | N-[[(2S)-2,3-dihydro-1-benzofuran-2-yl]methyl]-2-hydroxy-3-nitrobenzamide |
| SMILES | O=C(NC[C@@H]1Cc2ccccc2O1)c1cccc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C16H14N2O5/c19-15-12(5-3-6-13(15)18(21)22)16(20)17-9-11-8-10-4-1-2-7-14(10)23-11/h1-7,11,19H,8-9H2,(H,17,20)/t11-/m0/s1 |
| InChIKey | HOZUHXHVAKSATG-NSHDSACASA-N |
| XLogP | 2.03 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|