C16H13BrFNO2 — CID 115678361
2-bromo-N-(2,3-dihydro-1-benzofuran-2-ylmethyl)-6-fluorobenzamide (PubChem CID 115678361) has the molecular formula C16H13BrFNO2 and a molecular weight of 350.19 g/mol. Its IUPAC name is 2-bromo-N-(2,3-dihydro-1-benzofuran-2-ylmethyl)-6-fluorobenzamide.
| Compound Name | 2-bromo-N-(2,3-dihydro-1-benzofuran-2-ylmethyl)-6-fluorobenzamide |
|---|---|
| PubChem CID | 115678361 |
| Molecular Formula | C16H13BrFNO2 |
| Molecular Weight | 350.19 g/mol |
| Exact Mass | 349.01 |
| IUPAC Name | 2-bromo-N-(2,3-dihydro-1-benzofuran-2-ylmethyl)-6-fluorobenzamide |
| SMILES | O=C(NCC1Cc2ccccc2O1)c1c(F)cccc1Br |
| InChI | InChI=1S/C16H13BrFNO2/c17-12-5-3-6-13(18)15(12)16(20)19-9-11-8-10-4-1-2-7-14(10)21-11/h1-7,11H,8-9H2,(H,19,20) |
| InChIKey | RRZVDXAISFCSLM-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.19 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |