C12H13NO4 — CID 62229922
3-(2,3-dihydro-1-benzofuran-2-ylmethylamino)-3-oxopropanoic acid (PubChem CID 62229922) has the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. Its IUPAC name is 3-(2,3-dihydro-1-benzofuran-2-ylmethylamino)-3-oxopropanoic acid.
| Compound Name | 3-(2,3-dihydro-1-benzofuran-2-ylmethylamino)-3-oxopropanoic acid |
|---|---|
| PubChem CID | 62229922 |
| Molecular Formula | C12H13NO4 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 3-(2,3-dihydro-1-benzofuran-2-ylmethylamino)-3-oxopropanoic acid |
| SMILES | O=C(O)CC(=O)NCC1Cc2ccccc2O1 |
| InChI | InChI=1S/C12H13NO4/c14-11(6-12(15)16)13-7-9-5-8-3-1-2-4-10(8)17-9/h1-4,9H,5-7H2,(H,13,14)(H,15,16) |
| InChIKey | PNWNSADJADBVJV-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|