C14H14N2O5 — CID 76937693
4-(2,3-dihydro-1-benzofuran-2-ylmethylcarbamoylamino)-4-oxobut-2-enoic acid (PubChem CID 76937693) has the molecular formula C14H14N2O5 and a molecular weight of 290.27 g/mol. Its IUPAC name is 4-(2,3-dihydro-1-benzofuran-2-ylmethylcarbamoylamino)-4-oxobut-2-enoic acid.
| Compound Name | 4-(2,3-dihydro-1-benzofuran-2-ylmethylcarbamoylamino)-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 76937693 |
| Molecular Formula | C14H14N2O5 |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 4-(2,3-dihydro-1-benzofuran-2-ylmethylcarbamoylamino)-4-oxobut-2-enoic acid |
| SMILES | O=C(O)C=CC(=O)NC(=O)NCC1Cc2ccccc2O1 |
| InChI | InChI=1S/C14H14N2O5/c17-12(5-6-13(18)19)16-14(20)15-8-10-7-9-3-1-2-4-11(9)21-10/h1-6,10H,7-8H2,(H,18,19)(H2,15,16,17,20) |
| InChIKey | MCGIGPMZTDWJDU-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|