C12H13NO2 — CID 61003696
N-(2,3-dihydro-1-benzofuran-2-ylmethyl)prop-2-enamide (PubChem CID 61003696) has the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. Its IUPAC name is N-(2,3-dihydro-1-benzofuran-2-ylmethyl)prop-2-enamide.
| Compound Name | N-(2,3-dihydro-1-benzofuran-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 61003696 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | N-(2,3-dihydro-1-benzofuran-2-ylmethyl)prop-2-enamide |
| SMILES | C=CC(=O)NCC1Cc2ccccc2O1 |
| InChI | InChI=1S/C12H13NO2/c1-2-12(14)13-8-10-7-9-5-3-4-6-11(9)15-10/h2-6,10H,1,7-8H2,(H,13,14) |
| InChIKey | CZXZQFHMNIGGBJ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|