C18H20N2O2 — CID 19065269
N-[2-(2,3-dihydro-1-benzofuran-2-ylmethylamino)ethyl]benzamide (PubChem CID 19065269) has the molecular formula C18H20N2O2 and a molecular weight of 296.37 g/mol. Its IUPAC name is N-[2-(2,3-dihydro-1-benzofuran-2-ylmethylamino)ethyl]benzamide.
| Compound Name | N-[2-(2,3-dihydro-1-benzofuran-2-ylmethylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 19065269 |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | N-[2-(2,3-dihydro-1-benzofuran-2-ylmethylamino)ethyl]benzamide |
| SMILES | O=C(NCCNCC1Cc2ccccc2O1)c1ccccc1 |
| InChI | InChI=1S/C18H20N2O2/c21-18(14-6-2-1-3-7-14)20-11-10-19-13-16-12-15-8-4-5-9-17(15)22-16/h1-9,16,19H,10-13H2,(H,20,21) |
| InChIKey | FQLMZURXPAQJDN-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|