C18H20ClFN2O2 — CID 139824743
N-[2-[[(2R)-2,3-dihydro-1-benzofuran-2-yl]methylamino]ethyl]-4-fluorobenzamide;hydrochloride (PubChem CID 139824743) has the molecular formula C18H20ClFN2O2 and a molecular weight of 350.82 g/mol. Its IUPAC name is N-[2-[[(2R)-2,3-dihydro-1-benzofuran-2-yl]methylamino]ethyl]-4-fluorobenzamide;hydrochloride.
| Compound Name | N-[2-[[(2R)-2,3-dihydro-1-benzofuran-2-yl]methylamino]ethyl]-4-fluorobenzamide;hydrochloride |
|---|---|
| PubChem CID | 139824743 |
| Molecular Formula | C18H20ClFN2O2 |
| Molecular Weight | 350.82 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | N-[2-[[(2R)-2,3-dihydro-1-benzofuran-2-yl]methylamino]ethyl]-4-fluorobenzamide;hydrochloride |
| SMILES | Cl.O=C(NCCNC[C@H]1Cc2ccccc2O1)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H19FN2O2.ClH/c19-15-7-5-13(6-8-15)18(22)21-10-9-20-12-16-11-14-3-1-2-4-17(14)23-16;/h1-8,16,20H,9-12H2,(H,21,22);1H/t16-;/m1./s1 |
| InChIKey | PRAJECKKEXKCMF-PKLMIRHRSA-N |
| XLogP | 2.57 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.82 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|