C10H9N2O5- — CID 22667843
2-(6-nitro-3,4-dihydro-2H-1,4-benzoxazin-2-yl)acetate (PubChem CID 22667843) has the molecular formula C10H9N2O5- and a molecular weight of 237.19 g/mol. Its IUPAC name is 2-(6-nitro-3,4-dihydro-2H-1,4-benzoxazin-2-yl)acetate.
| Compound Name | 2-(6-nitro-3,4-dihydro-2H-1,4-benzoxazin-2-yl)acetate |
|---|---|
| PubChem CID | 22667843 |
| Molecular Formula | C10H9N2O5- |
| Molecular Weight | 237.19 g/mol |
| Exact Mass | 237.05 |
| IUPAC Name | 2-(6-nitro-3,4-dihydro-2H-1,4-benzoxazin-2-yl)acetate |
| SMILES | O=C([O-])CC1CNc2cc([N+](=O)[O-])ccc2O1 |
| InChI | InChI=1S/C10H10N2O5/c13-10(14)4-7-5-11-8-3-6(12(15)16)1-2-9(8)17-7/h1-3,7,11H,4-5H2,(H,13,14)/p-1 |
| InChIKey | KPBVXPIGDCTLDJ-UHFFFAOYSA-M |
| XLogP | -0.09 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.19 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|